CAS 36701-91-4 appears in our catalog under these names: 2-(2,4-Dichlorophenoxy)pyridine-3-carboxylic acid, 95%, 2-(2,4-Dichlorophenoxy)nicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(2,4-dichlorophenoxy)pyridine-3-carboxylic acid (CAS 36701-91-4) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)pyridine-3-carboxylic acid. InChIKey: OEDCZDYPFJEWIH-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)pyridine-3-carboxylic acid |
| InChIKey | OEDCZDYPFJEWIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)