CAS 22544-07-6 appears in our catalog under these names: 2-Chloro-1-(4-chlorophenoxy)-4-nitrobenzene, 95%, 2–Chloro–1–(4–chlorophenoxy)–4–nitrobenzene, 2-Chloro-1-(4-chlorophenoxy)-4-nitrobenzene, 95%, 95%, 2-Chloro-1-(4-chlorophenoxy)-4-nitrobenzene. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
2-chloro-1-(4-chlorophenoxy)-4-nitrobenzene (CAS 22544-07-6) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 2-chloro-1-(4-chlorophenoxy)-4-nitrobenzene. InChIKey: RTCVXHVOOYCYNA-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 2-chloro-1-(4-chlorophenoxy)-4-nitrobenzene |
| InChIKey | RTCVXHVOOYCYNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)