Products 79294-87-4
CAS 79294-87-4 is the registry number for 1,2-Dichloro-4-(2-nitrophenoxy)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1,2-dichloro-4-(2-nitrophenoxy)benzene (CAS 79294-87-4) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 1,2-dichloro-4-(2-nitrophenoxy)benzene. InChIKey: NJQQKGNHFXILEG-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 1,2-dichloro-4-(2-nitrophenoxy)benzene |
| InChIKey | NJQQKGNHFXILEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)