Products 886361-05-3
CAS 886361-05-3 is the registry number for 4-(2,4-Dichlorobenzoyl)-1H-pyrrole-2-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylic acid (CAS 886361-05-3) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylic acid. InChIKey: UKGSCFPMDBMXQI-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | UKGSCFPMDBMXQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)C2=CNC(=C2)C(=O)O |
Computed by PubChem (NCBI)