Products 143028-31-3
CAS 143028-31-3 is the registry number for 6-(3,4-Dichlorophenoxy)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(3,4-dichlorophenoxy)pyridine-2-carboxylic acid (CAS 143028-31-3) is a chemical compound with the molecular formula C12H7Cl2NO3 and a molecular weight of 284.09 g/mol. IUPAC name: 6-(3,4-dichlorophenoxy)pyridine-2-carboxylic acid. InChIKey: SCXBSWPJJRNIHJ-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3 |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 6-(3,4-dichlorophenoxy)pyridine-2-carboxylic acid |
| InChIKey | SCXBSWPJJRNIHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OC2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)