CAS 1019769-46-0 appears in our catalog under these names: Zilpaterol Impurity 2, 6-Amino-5,6-dihydroimidazo(4,5,1-jk)(1)benzazepine-2,7(1H,4H)-dione. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
10-amino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione (CAS 1019769-46-0) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 10-amino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione. InChIKey: PDJQUKXBCPSQAQ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 10-amino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione |
| InChIKey | PDJQUKXBCPSQAQ-UHFFFAOYSA-N |
| SMILES | C1CN2C3=C(C=CC=C3NC2=O)C(=O)C1N |
Computed by PubChem (NCBI)