Products 1019849-13-8
CAS 1019849-13-8 appears in our catalog under these names: (2S,4R)-4-Azidopyrrolidine-2-carboxylic acid hydrochloride, 95%, (2S,4R)-H-L-Pro(4-N3)-OH, H-L-Pro(4-N3)-OH*HCl (2S,4R). Offered by: Combi-blocks, MedChemExpress, Iris Biotech. Available pack sizes: 100mg, 5g, 1g, 250mg, Get quote, 500mg.
(2S,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride (CAS 1019849-13-8) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: (2S,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: BVURXEMVHARMIF-HJXLNUONSA-N.
| Molecular formula | C5H9ClN4O2 |
|---|---|
| Molecular weight | 192.60 g/mol |
| IUPAC name | (2S,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | BVURXEMVHARMIF-HJXLNUONSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)