Products 2737202-69-4
CAS 2737202-69-4 appears in our catalog under these names: (2R,4R)-4-Azidopyrrolidine-2-carboxylic acid hydrochloride, 95%, H-D-Pro(4-N3)-OH*HCl (2R,4R), (2R,4R)-H-D-Pro(4-N3)-OH (hydrochloride). Offered by: Combi-blocks, Iris Biotech, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, Get quote.
(2R,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride (CAS 2737202-69-4) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: (2R,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: BVURXEMVHARMIF-VKKIDBQXSA-N.
| Molecular formula | C5H9ClN4O2 |
|---|---|
| Molecular weight | 192.60 g/mol |
| IUPAC name | (2R,4R)-4-azidopyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | BVURXEMVHARMIF-VKKIDBQXSA-N |
| SMILES | C1[C@H](CN[C@H]1C(=O)O)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)