Products 1279219-32-7

CAS 1279219-32-7 is the registry number for Methyl (3-amino-1h-1,2,4-triazol-5-yl)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(3-amino-1H-1,2,4-triazol-5-yl)acetate;hydrochloride (CAS 1279219-32-7) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: methyl 2-(3-amino-1H-1,2,4-triazol-5-yl)acetate;hydrochloride. InChIKey: BQMZIQANWPKELV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN4O2
Molecular weight192.60 g/mol
IUPAC namemethyl 2-(3-amino-1H-1,2,4-triazol-5-yl)acetate;hydrochloride
InChIKeyBQMZIQANWPKELV-UHFFFAOYSA-N
SMILESCOC(=O)CC1=NC(=NN1)N.Cl

Computed by PubChem (NCBI)