CAS 116989-51-6 appears in our catalog under these names: 2-(2-Nitro-1h-imidazol-1-yl)ethanamine hydrochloride, 95%, 2-(2-Nitro-1H-imidazol-1-yl)ethanamine hydrochloride, 2-(2-Nitro-1H-imidazol-1-yl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 0,5g.
2-(2-nitroimidazol-1-yl)ethanamine;hydrochloride (CAS 116989-51-6) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: 2-(2-nitroimidazol-1-yl)ethanamine;hydrochloride. InChIKey: UNLRFFXZTJXMPL-UHFFFAOYSA-N.
| Molecular formula | C5H9ClN4O2 |
|---|---|
| Molecular weight | 192.60 g/mol |
| IUPAC name | 2-(2-nitroimidazol-1-yl)ethanamine;hydrochloride |
| InChIKey | UNLRFFXZTJXMPL-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)[N+](=O)[O-])CCN.Cl |
Computed by PubChem (NCBI)