Products 2361677-70-3

CAS 2361677-70-3 is the registry number for 2-(3-(Aminomethyl)-1H-1,2,4-triazol-1-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[3-(aminomethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride (CAS 2361677-70-3) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: 2-[3-(aminomethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride. InChIKey: OUXXZVYISOJRCH-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN4O2
Molecular weight192.60 g/mol
IUPAC name2-[3-(aminomethyl)-1,2,4-triazol-1-yl]acetic acid;hydrochloride
InChIKeyOUXXZVYISOJRCH-UHFFFAOYSA-N
SMILESC1=NC(=NN1CC(=O)O)CN.Cl

Computed by PubChem (NCBI)