CAS 1197235-00-9 is the registry number for [2-(3-Nitro-1H-pyrazol-1-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(3-nitropyrazol-1-yl)ethanamine;hydrochloride (CAS 1197235-00-9) is a chemical compound with the molecular formula C5H9ClN4O2 and a molecular weight of 192.60 g/mol. IUPAC name: 2-(3-nitropyrazol-1-yl)ethanamine;hydrochloride. InChIKey: JCQJYMDOUIIXPF-UHFFFAOYSA-N.
| Molecular formula | C5H9ClN4O2 |
|---|---|
| Molecular weight | 192.60 g/mol |
| IUPAC name | 2-(3-nitropyrazol-1-yl)ethanamine;hydrochloride |
| InChIKey | JCQJYMDOUIIXPF-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1[N+](=O)[O-])CCN.Cl |
Computed by PubChem (NCBI)