Products 1020097-79-3
CAS 1020097-79-3 is the registry number for rac-Methyl 2-((1R,2S)-2-{((tert-butoxy)carbonyl)amino}cyclopentyl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-[(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetate (CAS 1020097-79-3) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: methyl 2-[(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetate. InChIKey: BLVYUMDDYPUXLH-ZJUUUORDSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | methyl 2-[(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetate |
| InChIKey | BLVYUMDDYPUXLH-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H]1CC(=O)OC |
Computed by PubChem (NCBI)