Products 1020252-19-0
CAS 1020252-19-0 is the registry number for 1-(4,5-dichloroimidazolyl)-3,3-dimethylbutan-2-one. Offered by: Biosynth. Available pack sizes: 10g, 25g.
1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one (CAS 1020252-19-0) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one. InChIKey: BGKMCAYBCDYDHG-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-one |
| InChIKey | BGKMCAYBCDYDHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CN1C=NC(=C1Cl)Cl |
Computed by PubChem (NCBI)