Products 1052545-13-7
CAS 1052545-13-7 appears in our catalog under these names: 2-Amino-n-(3-chloro-2-methylphenyl)acetamide hydrochloride, 90%, 2-Amino-N-(3-chloro-2-methylphenyl)acetamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
2-amino-N-(3-chloro-2-methylphenyl)acetamide;hydrochloride (CAS 1052545-13-7) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 2-amino-N-(3-chloro-2-methylphenyl)acetamide;hydrochloride. InChIKey: AYPRSUGWZQNQCS-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 2-amino-N-(3-chloro-2-methylphenyl)acetamide;hydrochloride |
| InChIKey | AYPRSUGWZQNQCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)CN.Cl |
Computed by PubChem (NCBI)