Products 1179140-48-7
CAS 1179140-48-7 is the registry number for 2-((2-Aminoethylamino)methyl)-4,6-dichlorophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
2-[(2-aminoethylamino)methyl]-4,6-dichlorophenol (CAS 1179140-48-7) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 2-[(2-aminoethylamino)methyl]-4,6-dichlorophenol. InChIKey: CBHOZLSOMBNGMR-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 2-[(2-aminoethylamino)methyl]-4,6-dichlorophenol |
| InChIKey | CBHOZLSOMBNGMR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CNCCN)O)Cl)Cl |
Computed by PubChem (NCBI)