Products 1245568-68-6

CAS 1245568-68-6 is the registry number for 3-Amino-n-(4-chlorophenyl)propanamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-N-(4-chlorophenyl)propanamide;hydrochloride (CAS 1245568-68-6) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 3-amino-N-(4-chlorophenyl)propanamide;hydrochloride. InChIKey: GNBWWTPFIYEPLA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2O
Molecular weight235.11 g/mol
IUPAC name3-amino-N-(4-chlorophenyl)propanamide;hydrochloride
InChIKeyGNBWWTPFIYEPLA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)CCN)Cl.Cl

Computed by PubChem (NCBI)