CAS 2095410-16-3 is the registry number for Azetidin-3-yl(pyridin-2-yl)methanone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Azetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride (CAS 2095410-16-3) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: azetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride. InChIKey: VIYVIKULPZBXCV-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | azetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride |
| InChIKey | VIYVIKULPZBXCV-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C(=O)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)