Products 2095410-16-3

CAS 2095410-16-3 is the registry number for Azetidin-3-yl(pyridin-2-yl)methanone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Azetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride (CAS 2095410-16-3) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: azetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride. InChIKey: VIYVIKULPZBXCV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2O
Molecular weight235.11 g/mol
IUPAC nameazetidin-3-yl(pyridin-2-yl)methanone;dihydrochloride
InChIKeyVIYVIKULPZBXCV-UHFFFAOYSA-N
SMILESC1C(CN1)C(=O)C2=CC=CC=N2.Cl.Cl

Computed by PubChem (NCBI)