Products 94319-83-2
CAS 94319-83-2 appears in our catalog under these names: N-(2-Aminoethyl)-2-chlorobenzamide hydrochloride, 95%, N-(2-Aminoethyl)-2-chlorobenzamide hydrochloride, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g.
N-(2-aminoethyl)-2-chlorobenzamide;hydrochloride (CAS 94319-83-2) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: N-(2-aminoethyl)-2-chlorobenzamide;hydrochloride. InChIKey: RBXHARJYLYRYSI-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-chlorobenzamide;hydrochloride |
| InChIKey | RBXHARJYLYRYSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCN)Cl.Cl |
Computed by PubChem (NCBI)