CAS 10205-71-7 appears in our catalog under these names: 4–(6–Methoxybenzo(d)thiazol–2–yl)–N,N–dimethylaniline, 4-(6-Methoxybenzo[d]thiazol-2-yl)-N,N-dimethylaniline 95%, 4-(6-Methoxybenzo[d]thiazol-2-yl)-N,N-dimethylaniline, 95%, 95%, 4-(6-Methoxybenzo[d]thiazol-2-yl)-N,N-dimethylaniline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline (CAS 10205-71-7) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: 4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline. InChIKey: POFIKJKJPDPHTI-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| InChIKey | POFIKJKJPDPHTI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)OC |
Computed by PubChem (NCBI)