CAS 1374509-65-5 is the registry number for 2-Imino-7,7-dimethyl-4-phenyl-2,6,7,8-tetrahydro-5h-1,3-benzothiazin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-1,3-benzothiazin-5-one (CAS 1374509-65-5) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: 2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-1,3-benzothiazin-5-one. InChIKey: CVNBOBIQEFKCRA-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-1,3-benzothiazin-5-one |
| InChIKey | CVNBOBIQEFKCRA-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NC(=N)S2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)