CAS 1306986-31-1 is the registry number for 5-Methyl-1-(2-phenoxyethyl)-1H-1,3-benzodiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-methyl-3-(2-phenoxyethyl)-1H-benzimidazole-2-thione (CAS 1306986-31-1) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: 6-methyl-3-(2-phenoxyethyl)-1H-benzimidazole-2-thione. InChIKey: QUNADYNVDIDTNP-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 6-methyl-3-(2-phenoxyethyl)-1H-benzimidazole-2-thione |
| InChIKey | QUNADYNVDIDTNP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=S)N2)CCOC3=CC=CC=C3 |
Computed by PubChem (NCBI)