Products 743452-45-1

CAS 743452-45-1 is the registry number for N-Benzyl-6-ethoxy-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine (CAS 743452-45-1) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: N-benzyl-6-ethoxy-1,3-benzothiazol-2-amine. InChIKey: WGWKHFGRLSGXBF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N2OS
Molecular weight284.4 g/mol
IUPAC nameN-benzyl-6-ethoxy-1,3-benzothiazol-2-amine
InChIKeyWGWKHFGRLSGXBF-UHFFFAOYSA-N
SMILESCCOC1=CC2=C(C=C1)N=C(S2)NCC3=CC=CC=C3

Computed by PubChem (NCBI)