CAS 459443-11-9 is the registry number for 6-Methyl-3-{[(thiophen-2-ylmethyl)-amino]-methyl}-1H-quinolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-3-[(thiophen-2-ylmethylamino)methyl]-1H-quinolin-2-one (CAS 459443-11-9) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: 6-methyl-3-[(thiophen-2-ylmethylamino)methyl]-1H-quinolin-2-one. InChIKey: AHNXSFJSKWMDIY-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 6-methyl-3-[(thiophen-2-ylmethylamino)methyl]-1H-quinolin-2-one |
| InChIKey | AHNXSFJSKWMDIY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C(=C2)CNCC3=CC=CS3 |
Computed by PubChem (NCBI)