CAS 117174-79-5 is the registry number for 1-Benzoyl-3-(3,5-dimethylphenyl)thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(3,5-dimethylphenyl)carbamothioyl]benzamide (CAS 117174-79-5) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: N-[(3,5-dimethylphenyl)carbamothioyl]benzamide. InChIKey: YAEFVXZQXWJXLF-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | N-[(3,5-dimethylphenyl)carbamothioyl]benzamide |
| InChIKey | YAEFVXZQXWJXLF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=S)NC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)