CAS 1020997-14-1 appears in our catalog under these names: 3-(3,5-Dichlorophenyl)isoxazol-5-amine, 95+%, 3-(3,5-Dichlorophenyl)-1,2-oxazol-5-amine, 3-(3,5-Dichlorophenyl)-1,2-oxazol-5-amine, 95%, 95%, 3-(3,5-Dichlorophenyl)-1,2-oxazol-5-amine, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 2.5g.
3-(3,5-dichlorophenyl)-1,2-oxazol-5-amine (CAS 1020997-14-1) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-1,2-oxazol-5-amine. InChIKey: JCTZJUPAALEVOL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)-1,2-oxazol-5-amine |
| InChIKey | JCTZJUPAALEVOL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NOC(=C2)N |
Computed by PubChem (NCBI)