CAS 1021-91-6 appears in our catalog under these names: 5H–Dibenzo(a,d)(7)annulen–5–one oxime, 5H-Dibenzo[a,d][7]annulen-5-one oxime, 95+%, 95+%, 5H-Dibenzo[a,d][7]annulen-5-one oxime, 95+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)hydroxylamine (CAS 1021-91-6) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)hydroxylamine. InChIKey: LRBLEEPNJOPXOB-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)hydroxylamine |
| InChIKey | LRBLEEPNJOPXOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3C2=NO |
Computed by PubChem (NCBI)