Products 1021871-32-8
CAS 1021871-32-8 is the registry number for 2-(Bromomethyl)-1-chloro-4-(methylsulfonyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(bromomethyl)-1-chloro-4-methylsulfonylbenzene (CAS 1021871-32-8) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-4-methylsulfonylbenzene. InChIKey: DUUOLILDQXAKQZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-4-methylsulfonylbenzene |
| InChIKey | DUUOLILDQXAKQZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)CBr |
Computed by PubChem (NCBI)