CAS 1022080-99-4 appears in our catalog under these names: (2E)-3-(3-Chloro-4,5-dimethoxyphenyl)acrylic acid, 95%, (2E)-3-(3-Chloro-4,5-dimethoxyphenyl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoic acid (CAS 1022080-99-4) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: FZFFFBWBOZMKEP-ONEGZZNKSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | FZFFFBWBOZMKEP-ONEGZZNKSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C=C/C(=O)O)Cl)OC |
Computed by PubChem (NCBI)