Products 1423026-12-3
CAS 1423026-12-3 appears in our catalog under these names: Methyl 3-(1-chloro-2-methoxy-2-oxoethyl)benzoate, 95%, Methyl 3-(1-chloro-2-methoxy-2-oxoethyl)benzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 3-(1-chloro-2-methoxy-2-oxoethyl)benzoate (CAS 1423026-12-3) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: methyl 3-(1-chloro-2-methoxy-2-oxoethyl)benzoate. InChIKey: KTOABCRNHOSVKZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | methyl 3-(1-chloro-2-methoxy-2-oxoethyl)benzoate |
| InChIKey | KTOABCRNHOSVKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(C(=O)OC)Cl |
Computed by PubChem (NCBI)