CAS 103857-58-5 appears in our catalog under these names: Baclofen Impurity 8, Baclofen Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-chlorophenyl)pentanedioic acid (CAS 103857-58-5) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: 3-(2-chlorophenyl)pentanedioic acid. InChIKey: PJKBYPAWXJAYHK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 3-(2-chlorophenyl)pentanedioic acid |
| InChIKey | PJKBYPAWXJAYHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CC(=O)O)CC(=O)O)Cl |
Computed by PubChem (NCBI)