CAS 6518-91-8 appears in our catalog under these names: 4-(Chloromethyl)-6,7-dimethoxy-3h-1-isobenzofuranone, 95%, 4–(Chloromethyl)–6,7–dimethoxy–3H–1–isobenzofuranone, 4-(CHLOROMETHYL)-6,7-DIMETHOXY-3H-1-ISOBENZOFURANONE. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-(chloromethyl)-6,7-dimethoxy-3H-2-benzofuran-1-one (CAS 6518-91-8) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: 4-(chloromethyl)-6,7-dimethoxy-3H-2-benzofuran-1-one. InChIKey: AHWVGGSUPOUZPQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 4-(chloromethyl)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| InChIKey | AHWVGGSUPOUZPQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(COC2=O)C(=C1)CCl)OC |
Computed by PubChem (NCBI)