CAS 99854-17-8 appears in our catalog under these names: 3-(2-Chloro-3,4-dimethoxyphenyl)acrylic acid, 95% , 3-(2-Chloro-3,4-dimethoxyphenyl)acrylic acid, 95%. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 10g, 1g, 5g.
(E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoic acid (CAS 99854-17-8) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoic acid. InChIKey: JIPTVEJKXDVECY-GQCTYLIASA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | JIPTVEJKXDVECY-GQCTYLIASA-N |
| SMILES | COC1=C(C(=C(C=C1)/C=C/C(=O)O)Cl)OC |
Computed by PubChem (NCBI)