CAS 1385787-79-0 is the registry number for Ethyl 8-chloro-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (CAS 1385787-79-0) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: ethyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate. InChIKey: BHVWVCADPBFUCZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | ethyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| InChIKey | BHVWVCADPBFUCZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=C1)Cl)OCCO2 |
Computed by PubChem (NCBI)