Products 1022252-78-3
CAS 1022252-78-3 is the registry number for 4-benzo(d)1,3-dioxolan-5-yl-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(1,3-benzodioxol-5-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one (CAS 1022252-78-3) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one. InChIKey: VDVSCTTUPLLAHW-UHFFFAOYSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one |
| InChIKey | VDVSCTTUPLLAHW-UHFFFAOYSA-N |
| SMILES | COC1C(N(C1=O)C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)