CAS 1023482-45-2 is the registry number for 2-(((3-Acetylphenyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
2-[(3-acetylphenyl)iminomethyl]-3-hydroxyinden-1-one (CAS 1023482-45-2) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 2-[(3-acetylphenyl)iminomethyl]-3-hydroxyinden-1-one. InChIKey: LGIDVZWEZTZDTQ-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2-[(3-acetylphenyl)iminomethyl]-3-hydroxyinden-1-one |
| InChIKey | LGIDVZWEZTZDTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N=CC2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)