CAS 605685-94-7 is the registry number for NSC 641396. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-methoxy-11-methylbenzo[a]carbazole-1,4-dione (CAS 605685-94-7) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 8-methoxy-11-methylbenzo[a]carbazole-1,4-dione. InChIKey: NJELFFLROCNKMT-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 8-methoxy-11-methylbenzo[a]carbazole-1,4-dione |
| InChIKey | NJELFFLROCNKMT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)OC)C3=C1C4=C(C=C3)C(=O)C=CC4=O |
Computed by PubChem (NCBI)