CAS 384364-82-3 is the registry number for 3-Cinnamoyl-4-hydroxyquinolin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1H-quinolin-2-one (CAS 384364-82-3) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1H-quinolin-2-one. InChIKey: XPDNUSJWBCWJDS-ZHACJKMWSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1H-quinolin-2-one |
| InChIKey | XPDNUSJWBCWJDS-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=C(C3=CC=CC=C3NC2=O)O |
Computed by PubChem (NCBI)