CAS 31060-55-6 is the registry number for N-(4-((1,3-dioxoindan-2-ylidene)methyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]acetamide (CAS 31060-55-6) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]acetamide. InChIKey: ORMQVPHTBVYDPV-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]acetamide |
| InChIKey | ORMQVPHTBVYDPV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C=C2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)