Products 1023554-70-2
CAS 1023554-70-2 is the registry number for 2-(((4,4-dimethyl-2,6-dioxo(3,5-dioxanylidene))methyl)amino)-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid (CAS 1023554-70-2) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid. InChIKey: PHYOERRDQFSKCB-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoic acid |
| InChIKey | PHYOERRDQFSKCB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC=C2C(=O)OC(OC2=O)(C)C)C(=O)O |
Computed by PubChem (NCBI)