CAS 497060-16-9 is the registry number for 4-((((4,4-Dimethyl-2,6-dioxo-3,5-dioxanylidene)methyl)amino)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 10g, 25g.
4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]methyl]benzoic acid (CAS 497060-16-9) is a chemical compound with the molecular formula C15H15NO6 and a molecular weight of 305.28 g/mol. IUPAC name: 4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]methyl]benzoic acid. InChIKey: QPBKTCPUVGQYHQ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO6 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | 4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]methyl]benzoic acid |
| InChIKey | QPBKTCPUVGQYHQ-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNCC2=CC=C(C=C2)C(=O)O)C(=O)O1)C |
Computed by PubChem (NCBI)