CAS 1024547-41-8 is the registry number for 3-(4-chloro-3-methylphenyl)-7-methyl-1,4,6,7,8-pentahydrocinnolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-chloro-3-methylphenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one (CAS 1024547-41-8) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: 3-(4-chloro-3-methylphenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one. InChIKey: BGAHDUVMRXOICD-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 3-(4-chloro-3-methylphenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one |
| InChIKey | BGAHDUVMRXOICD-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CC(=NN2)C3=CC(=C(C=C3)Cl)C)C(=O)C1 |
Computed by PubChem (NCBI)