CAS 1445127-44-5 is the registry number for (3-(4-Phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine;hydrochloride (CAS 1445127-44-5) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: [3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine;hydrochloride. InChIKey: WJHCKNMESFZKOC-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | [3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine;hydrochloride |
| InChIKey | WJHCKNMESFZKOC-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=C(C=C2)C3=CC=CC=C3)CN.Cl |
Computed by PubChem (NCBI)