Products 2044713-29-1
CAS 2044713-29-1 is the registry number for 3-(Aminomethyl)-2-benzyl-2,3-dihydro-1H-isoindol-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(aminomethyl)-2-benzyl-3H-isoindol-1-one;hydrochloride (CAS 2044713-29-1) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: 3-(aminomethyl)-2-benzyl-3H-isoindol-1-one;hydrochloride. InChIKey: JIHKVWTZSNVAFJ-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 3-(aminomethyl)-2-benzyl-3H-isoindol-1-one;hydrochloride |
| InChIKey | JIHKVWTZSNVAFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(C3=CC=CC=C3C2=O)CN.Cl |
Computed by PubChem (NCBI)