CAS 10250-99-4 is the registry number for Penicillenic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid (CAS 10250-99-4) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid. InChIKey: LQHOYSQHFLHJFQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | LQHOYSQHFLHJFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C(=O)O)N=CC1=C(OC=N1)O)S |
Computed by PubChem (NCBI)