Products 10250-99-4

CAS 10250-99-4 is the registry number for Penicillenic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid (CAS 10250-99-4) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid. InChIKey: LQHOYSQHFLHJFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O4S
Molecular weight244.27 g/mol
IUPAC name2-[(5-hydroxy-1,3-oxazol-4-yl)methylideneamino]-3-methyl-3-sulfanylbutanoic acid
InChIKeyLQHOYSQHFLHJFQ-UHFFFAOYSA-N
SMILESCC(C)(C(C(=O)O)N=CC1=C(OC=N1)O)S

Computed by PubChem (NCBI)