CAS 102541-24-2 is the registry number for 6-Chloro-7-methylchroman-4-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-7-methyl-2,3-dihydrochromen-4-one (CAS 102541-24-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 6-chloro-7-methyl-2,3-dihydrochromen-4-one. InChIKey: ABNQLTZOCRGBPC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 6-chloro-7-methyl-2,3-dihydrochromen-4-one |
| InChIKey | ABNQLTZOCRGBPC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=O)CCO2 |
Computed by PubChem (NCBI)