CAS 1025692-47-0 is the registry number for 1,2-Difluoro-4-((E)-2-nitroethenyl)benzene. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,2-difluoro-4-[(E)-2-nitroethenyl]benzene (CAS 1025692-47-0) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 1,2-difluoro-4-[(E)-2-nitroethenyl]benzene. InChIKey: MFUFIEVSMSIBOA-ONEGZZNKSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 1,2-difluoro-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | MFUFIEVSMSIBOA-ONEGZZNKSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)