CAS 1393179-52-6 is the registry number for 1,3-Difluoro-4-nitro-2-vinylbenzene, 97% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 50mg.
2-ethenyl-1,3-difluoro-4-nitrobenzene (CAS 1393179-52-6) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 2-ethenyl-1,3-difluoro-4-nitrobenzene. InChIKey: NTFUUVUXZJOSPM-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 2-ethenyl-1,3-difluoro-4-nitrobenzene |
| InChIKey | NTFUUVUXZJOSPM-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C=CC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)