CAS 865106-46-3 appears in our catalog under these names: 2H-1,4-Benzoxazin-3(4h)-one, 6,7-difluoro, 95%, 6,7-Difluoro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95+%, 6,7-Difluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g.
6,7-difluoro-4H-1,4-benzoxazin-3-one (CAS 865106-46-3) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 6,7-difluoro-4H-1,4-benzoxazin-3-one. InChIKey: WFAHKQSSFLPKGA-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 6,7-difluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | WFAHKQSSFLPKGA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)F)F |
Computed by PubChem (NCBI)