Products 58417-15-5

CAS 58417-15-5 is the registry number for 4-(Difluoromethoxy)phenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(difluoromethoxy)-4-isocyanatobenzene (CAS 58417-15-5) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 1-(difluoromethoxy)-4-isocyanatobenzene. InChIKey: XLUSNOUGZQJPRN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F2NO2
Molecular weight185.13 g/mol
IUPAC name1-(difluoromethoxy)-4-isocyanatobenzene
InChIKeyXLUSNOUGZQJPRN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N=C=O)OC(F)F

Computed by PubChem (NCBI)